C16H14N2O3 — CID 76891863
N-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76891863) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76891863 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C16H14N2O3/c19-16(13-7-10-3-1-2-4-12(10)18-13)17-11-5-6-14-15(8-11)21-9-20-14/h1-6,8,13,18H,7,9H2,(H,17,19) |
| InChIKey | VMWNWLKEJKHPSM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |