C12H13N3O4 — CID 78270217
N-(1,3-benzodioxol-5-yl)-6-oxodiazinane-3-carboxamide (PubChem CID 78270217) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-oxodiazinane-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-oxodiazinane-3-carboxamide |
|---|---|
| PubChem CID | 78270217 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-oxodiazinane-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc3c(c2)OCO3)NN1 |
| InChI | InChI=1S/C12H13N3O4/c16-11-4-2-8(14-15-11)12(17)13-7-1-3-9-10(5-7)19-6-18-9/h1,3,5,8,14H,2,4,6H2,(H,13,17)(H,15,16) |
| InChIKey | LEADUFGACFSJQE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |