C13H15N3O4 — CID 78211627
N-(1,3-benzodioxol-5-ylmethyl)-6-oxodiazinane-3-carboxamide (PubChem CID 78211627) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-oxodiazinane-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-oxodiazinane-3-carboxamide |
|---|---|
| PubChem CID | 78211627 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-oxodiazinane-3-carboxamide |
| SMILES | O=C1CCC(C(=O)NCc2ccc3c(c2)OCO3)NN1 |
| InChI | InChI=1S/C13H15N3O4/c17-12-4-2-9(15-16-12)13(18)14-6-8-1-3-10-11(5-8)20-7-19-10/h1,3,5,9,15H,2,4,6-7H2,(H,14,18)(H,16,17) |
| InChIKey | YRTJSBNSSDODST-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |