C13H17N3O3 — CID 63103835
N-(1,3-benzodioxol-5-yl)-5-methylpiperazine-2-carboxamide (PubChem CID 63103835) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-methylpiperazine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63103835 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-methylpiperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)Nc2ccc3c(c2)OCO3)CN1 |
| InChI | InChI=1S/C13H17N3O3/c1-8-5-15-10(6-14-8)13(17)16-9-2-3-11-12(4-9)19-7-18-11/h2-4,8,10,14-15H,5-7H2,1H3,(H,16,17) |
| InChIKey | REBNJFAVPVYHOJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |