C13H17N2O3+ — CID 3466512
N-(1,3-benzodioxol-5-yl)-1-methylpyrrolidin-1-ium-2-carboxamide (PubChem CID 3466512) has the molecular formula C13H17N2O3+ and a molecular weight of 249.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-methylpyrrolidin-1-ium-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-methylpyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 3466512 |
| Molecular Formula | C13H17N2O3+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-methylpyrrolidin-1-ium-2-carboxamide |
| SMILES | C[NH+]1CCCC1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16N2O3/c1-15-6-2-3-10(15)13(16)14-9-4-5-11-12(7-9)18-8-17-11/h4-5,7,10H,2-3,6,8H2,1H3,(H,14,16)/p+1 |
| InChIKey | GVUJOAGEZMFDHH-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |