C22H24N2O4 — CID 109150450
1-N-(1,3-benzodioxol-5-yl)-4-N-(3-methylphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109150450) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-yl)-4-N-(3-methylphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-yl)-4-N-(3-methylphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109150450 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-yl)-4-N-(3-methylphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCC(C(=O)Nc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-14-3-2-4-17(11-14)23-21(25)15-5-7-16(8-6-15)22(26)24-18-9-10-19-20(12-18)28-13-27-19/h2-4,9-12,15-16H,5-8,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | JVJTXRLHRDDQEN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |