C13H15NO5S — CID 110863226
N-(1,3-benzodioxol-5-yl)-1,1-dioxothiane-4-carboxamide (PubChem CID 110863226) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 110863226 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1,1-dioxothiane-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H15NO5S/c15-13(9-3-5-20(16,17)6-4-9)14-10-1-2-11-12(7-10)19-8-18-11/h1-2,7,9H,3-6,8H2,(H,14,15) |
| InChIKey | DZRNZZASDJCPOR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |