About 4-(azepan-2-yl)quinoline
4-(azepan-2-yl)quinoline (PubChem CID 81147055) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(azepan-2-yl)quinoline.
Molecular Properties
| Compound Name | 4-(azepan-2-yl)quinoline |
| PubChem CID | 81147055 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-(azepan-2-yl)quinoline |
| SMILES | c1ccc2c(C3CCCCCN3)ccnc2c1 |
| InChI | InChI=1S/C15H18N2/c1-2-7-15(16-10-5-1)13-9-11-17-14-8-4-3-6-12(13)14/h3-4,6,8-9,11,15-16H,1-2,5,7,10H2 |
| InChIKey | LCULQOPBXWJNCJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(azepan-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-2-yl)quinoline?
The IUPAC name of 4-(azepan-2-yl)quinoline (CID 81147055) is 4-(azepan-2-yl)quinoline.
What is the SMILES notation for 4-(azepan-2-yl)quinoline?
The canonical SMILES for 4-(azepan-2-yl)quinoline is c1ccc2c(C3CCCCCN3)ccnc2c1.
What is the InChIKey of 4-(azepan-2-yl)quinoline?
The InChIKey is LCULQOPBXWJNCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2/c1-2-7-15(16-10-5-1)13-9-11-17-14-8-4-3-6-12(13)14/h3-4,6,8-9,11,15-16H,1-2,5,7,10H2.
What are the key properties of 4-(azepan-2-yl)quinoline?
4-(azepan-2-yl)quinoline has a molecular weight of 226.32 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-2-yl)quinoline is sourced from PubChem (CID 81147055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).