C20H20N2 — CID 7144282
2-phenyl-4-[(2R)-piperidin-2-yl]quinoline (PubChem CID 7144282) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-phenyl-4-[(2R)-piperidin-2-yl]quinoline.
| Compound Name | 2-phenyl-4-[(2R)-piperidin-2-yl]quinoline |
|---|---|
| PubChem CID | 7144282 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-phenyl-4-[(2R)-piperidin-2-yl]quinoline |
| SMILES | c1ccc(-c2cc([C@H]3CCCCN3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H20N2/c1-2-8-15(9-3-1)20-14-17(18-11-6-7-13-21-18)16-10-4-5-12-19(16)22-20/h1-5,8-10,12,14,18,21H,6-7,11,13H2/t18-/m1/s1 |
| InChIKey | CTWLVOJVVMWDGE-GOSISDBHSA-N |
| XLogP | 4.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |