C22H23ClN2O — CID 121481969
2-(4-chlorophenyl)-4-[methoxy(piperidin-2-yl)methyl]quinoline (PubChem CID 121481969) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[methoxy(piperidin-2-yl)methyl]quinoline.
| Compound Name | 2-(4-chlorophenyl)-4-[methoxy(piperidin-2-yl)methyl]quinoline |
|---|---|
| PubChem CID | 121481969 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[methoxy(piperidin-2-yl)methyl]quinoline |
| SMILES | COC(c1cc(-c2ccc(Cl)cc2)nc2ccccc12)C1CCCCN1 |
| InChI | InChI=1S/C22H23ClN2O/c1-26-22(20-8-4-5-13-24-20)18-14-21(15-9-11-16(23)12-10-15)25-19-7-3-2-6-17(18)19/h2-3,6-7,9-12,14,20,22,24H,4-5,8,13H2,1H3 |
| InChIKey | NCYIOKGOOQUNHZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |