About 4-cyclopentylquinoline
4-cyclopentylquinoline (PubChem CID 57273226) has the molecular formula C14H15N
and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-cyclopentylquinoline.
Molecular Properties
| Compound Name | 4-cyclopentylquinoline |
| PubChem CID | 57273226 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-cyclopentylquinoline |
| SMILES | c1ccc2c(C3CCCC3)ccnc2c1 |
| InChI | InChI=1S/C14H15N/c1-2-6-11(5-1)12-9-10-15-14-8-4-3-7-13(12)14/h3-4,7-11H,1-2,5-6H2 |
| InChIKey | PHAHRGLBACWQEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopentylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylquinoline?
The IUPAC name of 4-cyclopentylquinoline (CID 57273226) is 4-cyclopentylquinoline.
What is the SMILES notation for 4-cyclopentylquinoline?
The canonical SMILES for 4-cyclopentylquinoline is c1ccc2c(C3CCCC3)ccnc2c1.
What is the InChIKey of 4-cyclopentylquinoline?
The InChIKey is PHAHRGLBACWQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N/c1-2-6-11(5-1)12-9-10-15-14-8-4-3-7-13(12)14/h3-4,7-11H,1-2,5-6H2.
What are the key properties of 4-cyclopentylquinoline?
4-cyclopentylquinoline has a molecular weight of 197.28 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylquinoline is sourced from PubChem (CID 57273226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).