C16H21NO2S — CID 142355386
ethane;2-methyl-4-quinolin-4-ylthiolane 1,1-dioxide (PubChem CID 142355386) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is ethane;2-methyl-4-quinolin-4-ylthiolane 1,1-dioxide.
| Compound Name | ethane;2-methyl-4-quinolin-4-ylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 142355386 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | ethane;2-methyl-4-quinolin-4-ylthiolane 1,1-dioxide |
| SMILES | CC.CC1CC(c2ccnc3ccccc23)CS1(=O)=O |
| InChI | InChI=1S/C14H15NO2S.C2H6/c1-10-8-11(9-18(10,16)17)12-6-7-15-14-5-3-2-4-13(12)14;1-2/h2-7,10-11H,8-9H2,1H3;1-2H3 |
| InChIKey | RXBCXECYQBEMIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |