C22H28N2O3 — CID 138680331
3-methyl-2-[[2-(4-quinolin-4-ylcyclohexyl)acetyl]amino]butanoic acid (PubChem CID 138680331) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-methyl-2-[[2-(4-quinolin-4-ylcyclohexyl)acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-(4-quinolin-4-ylcyclohexyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 138680331 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-methyl-2-[[2-(4-quinolin-4-ylcyclohexyl)acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CC1CCC(c2ccnc3ccccc23)CC1)C(=O)O |
| InChI | InChI=1S/C22H28N2O3/c1-14(2)21(22(26)27)24-20(25)13-15-7-9-16(10-8-15)17-11-12-23-19-6-4-3-5-18(17)19/h3-6,11-12,14-16,21H,7-10,13H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | OYGOZRLFMNVCGX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |