C25H36N2O — CID 139302691
N,N-bis(2-methylpropyl)-2-(4-quinolin-4-ylcyclohexyl)acetamide (PubChem CID 139302691) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-(4-quinolin-4-ylcyclohexyl)acetamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-(4-quinolin-4-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 139302691 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-(4-quinolin-4-ylcyclohexyl)acetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)CC1CCC(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C25H36N2O/c1-18(2)16-27(17-19(3)4)25(28)15-20-9-11-21(12-10-20)22-13-14-26-24-8-6-5-7-23(22)24/h5-8,13-14,18-21H,9-12,15-17H2,1-4H3 |
| InChIKey | XRJCWSRCEJILCZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |