C24H31NO3 — CID 160623464
methyl (2S)-4-oxo-2-propan-2-yl-5-(4-quinolin-4-ylcyclohexyl)pentanoate (PubChem CID 160623464) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is methyl (2S)-4-oxo-2-propan-2-yl-5-(4-quinolin-4-ylcyclohexyl)pentanoate.
| Compound Name | methyl (2S)-4-oxo-2-propan-2-yl-5-(4-quinolin-4-ylcyclohexyl)pentanoate |
|---|---|
| PubChem CID | 160623464 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | methyl (2S)-4-oxo-2-propan-2-yl-5-(4-quinolin-4-ylcyclohexyl)pentanoate |
| SMILES | COC(=O)[C@@H](CC(=O)CC1CCC(c2ccnc3ccccc23)CC1)C(C)C |
| InChI | InChI=1S/C24H31NO3/c1-16(2)22(24(27)28-3)15-19(26)14-17-8-10-18(11-9-17)20-12-13-25-23-7-5-4-6-21(20)23/h4-7,12-13,16-18,22H,8-11,14-15H2,1-3H3/t17?,18?,22-/m0/s1 |
| InChIKey | FXDLESAHECUOBZ-IRZJEQJZSA-N |
| XLogP | 5.30 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |