C26H27N3O3 — CID 175211489
[5-cyclopropyl-6-(4-quinolin-4-ylcyclohexanecarbonyl)-2-pyridinyl]methyl carbamate (PubChem CID 175211489) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [5-cyclopropyl-6-(4-quinolin-4-ylcyclohexanecarbonyl)-2-pyridinyl]methyl carbamate.
| Compound Name | [5-cyclopropyl-6-(4-quinolin-4-ylcyclohexanecarbonyl)-2-pyridinyl]methyl carbamate |
|---|---|
| PubChem CID | 175211489 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [5-cyclopropyl-6-(4-quinolin-4-ylcyclohexanecarbonyl)-2-pyridinyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(C2CC2)c(C(=O)C2CCC(c3ccnc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C26H27N3O3/c27-26(31)32-15-19-11-12-21(17-5-6-17)24(29-19)25(30)18-9-7-16(8-10-18)20-13-14-28-23-4-2-1-3-22(20)23/h1-4,11-14,16-18H,5-10,15H2,(H2,27,31) |
| InChIKey | VWTIRNYDBOKIBR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |