C22H25BrN2O — CID 134381366
[6-(aminomethyl)-3-cyclopropyl-2-pyridinyl]-[4-(4-bromophenyl)cyclohexyl]methanone (PubChem CID 134381366) has the molecular formula C22H25BrN2O and a molecular weight of 413.36 g/mol. Its IUPAC name is [6-(aminomethyl)-3-cyclopropyl-2-pyridinyl]-[4-(4-bromophenyl)cyclohexyl]methanone.
| Compound Name | [6-(aminomethyl)-3-cyclopropyl-2-pyridinyl]-[4-(4-bromophenyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 134381366 |
| Molecular Formula | C22H25BrN2O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [6-(aminomethyl)-3-cyclopropyl-2-pyridinyl]-[4-(4-bromophenyl)cyclohexyl]methanone |
| SMILES | NCc1ccc(C2CC2)c(C(=O)C2CCC(c3ccc(Br)cc3)CC2)n1 |
| InChI | InChI=1S/C22H25BrN2O/c23-18-9-7-15(8-10-18)14-1-5-17(6-2-14)22(26)21-20(16-3-4-16)12-11-19(13-24)25-21/h7-12,14,16-17H,1-6,13,24H2 |
| InChIKey | LNVJZJUSFXZJCS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |