C27H34N2O3 — CID 134381262
tert-butyl N-[[5-cyclopropyl-6-(4-phenylcyclohexanecarbonyl)-2-pyridinyl]methyl]carbamate (PubChem CID 134381262) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is tert-butyl N-[[5-cyclopropyl-6-(4-phenylcyclohexanecarbonyl)-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-cyclopropyl-6-(4-phenylcyclohexanecarbonyl)-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 134381262 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl N-[[5-cyclopropyl-6-(4-phenylcyclohexanecarbonyl)-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C2CC2)c(C(=O)C2CCC(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H34N2O3/c1-27(2,3)32-26(31)28-17-22-15-16-23(20-11-12-20)24(29-22)25(30)21-13-9-19(10-14-21)18-7-5-4-6-8-18/h4-8,15-16,19-21H,9-14,17H2,1-3H3,(H,28,31) |
| InChIKey | ODXSUSFSQAXXQB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |