C16H14ClNO — CID 129404863
(3R)-3-(3-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 129404863) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is (3R)-3-(3-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-(3-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 129404863 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3R)-3-(3-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO/c17-13-6-3-5-12(10-13)14-9-8-11-4-1-2-7-15(11)18-16(14)19/h1-7,10,14H,8-9H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | QYZPLEIQKQPNTH-CQSZACIVSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |