C16H14ClNS — CID 129405790
(3S)-3-(4-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione (PubChem CID 129405790) has the molecular formula C16H14ClNS and a molecular weight of 287.82 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione.
| Compound Name | (3S)-3-(4-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
|---|---|
| PubChem CID | 129405790 |
| Molecular Formula | C16H14ClNS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
| SMILES | S=C1Nc2ccccc2CC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNS/c17-13-8-5-11(6-9-13)14-10-7-12-3-1-2-4-15(12)18-16(14)19/h1-6,8-9,14H,7,10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | RNNCSNAIFVHWJD-AWEZNQCLSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|