C15H12ClNO — CID 737007
(1R)-1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 737007) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | (1R)-1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 737007 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | O=C1Cc2ccccc2[C@@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C15H12ClNO/c16-12-7-5-10(6-8-12)15-13-4-2-1-3-11(13)9-14(18)17-15/h1-8,15H,9H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | FKGZGLJTVBJZBZ-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |