C15H13ClN2O — CID 154101048
7-chloro-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepin-3-one (PubChem CID 154101048) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 7-chloro-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepin-3-one.
| Compound Name | 7-chloro-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepin-3-one |
|---|---|
| PubChem CID | 154101048 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 7-chloro-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepin-3-one |
| SMILES | O=C1CNc2ccc(Cl)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C15H13ClN2O/c16-11-6-7-13-12(8-11)15(18-14(19)9-17-13)10-4-2-1-3-5-10/h1-8,15,17H,9H2,(H,18,19) |
| InChIKey | PYDAGZCBSZIASX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |