C14H13ClN2 — CID 40649208
(4S)-6-chloro-4-phenyl-1,2,3,4-tetrahydroquinazoline (PubChem CID 40649208) has the molecular formula C14H13ClN2 and a molecular weight of 244.73 g/mol. Its IUPAC name is (4S)-6-chloro-4-phenyl-1,2,3,4-tetrahydroquinazoline.
| Compound Name | (4S)-6-chloro-4-phenyl-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 40649208 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (4S)-6-chloro-4-phenyl-1,2,3,4-tetrahydroquinazoline |
| SMILES | Clc1ccc2c(c1)[C@H](c1ccccc1)NCN2 |
| InChI | InChI=1S/C14H13ClN2/c15-11-6-7-13-12(8-11)14(17-9-16-13)10-4-2-1-3-5-10/h1-8,14,16-17H,9H2/t14-/m0/s1 |
| InChIKey | BZPWBVHPPQZBLJ-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |