C15H14ClN — CID 96956787
(1S)-6-chloro-1-phenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 96956787) has the molecular formula C15H14ClN and a molecular weight of 243.74 g/mol. Its IUPAC name is (1S)-6-chloro-1-phenyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-6-chloro-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 96956787 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (1S)-6-chloro-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Clc1ccc2c(c1)CCN[C@H]2c1ccccc1 |
| InChI | InChI=1S/C15H14ClN/c16-13-6-7-14-12(10-13)8-9-17-15(14)11-4-2-1-3-5-11/h1-7,10,15,17H,8-9H2/t15-/m0/s1 |
| InChIKey | PVQUZKPQNVDNHD-HNNXBMFYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |