C13H12ClNO — CID 84697255
2-chloro-4-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine (PubChem CID 84697255) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 2-chloro-4-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine.
| Compound Name | 2-chloro-4-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 84697255 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-chloro-4-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine |
| SMILES | Clc1cc2c(o1)CCNC2c1ccccc1 |
| InChI | InChI=1S/C13H12ClNO/c14-12-8-10-11(16-12)6-7-15-13(10)9-4-2-1-3-5-9/h1-5,8,13,15H,6-7H2 |
| InChIKey | IANIMUSQNZEYNM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |