C13H16N2 — CID 143874010
N-(4-methyl-6-phenyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine (PubChem CID 143874010) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is N-(4-methyl-6-phenyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine.
| Compound Name | N-(4-methyl-6-phenyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
|---|---|
| PubChem CID | 143874010 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-(4-methyl-6-phenyl-1,2,3,6-tetrahydropyridin-5-yl)methanimine |
| SMILES | C=NC1=C(C)CCNC1c1ccccc1 |
| InChI | InChI=1S/C13H16N2/c1-10-8-9-15-13(12(10)14-2)11-6-4-3-5-7-11/h3-7,13,15H,2,8-9H2,1H3 |
| InChIKey | PQTAREHQTRAAAI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|