C17H17NO5 — CID 52983570
oxalic acid;5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 52983570) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is oxalic acid;5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | oxalic acid;5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 52983570 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | oxalic acid;5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | O=C(O)C(=O)O.c1ccc(C2NCCOc3ccccc32)cc1 |
| InChI | InChI=1S/C15H15NO.C2H2O4/c1-2-6-12(7-3-1)15-13-8-4-5-9-14(13)17-11-10-16-15;3-1(4)2(5)6/h1-9,15-16H,10-11H2;(H,3,4)(H,5,6) |
| InChIKey | PNAOQWFMNUBKMC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|