C15H23NO — CID 132547359
5-hexyl-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 132547359) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5-hexyl-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 5-hexyl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 132547359 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5-hexyl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | CCCCCCC1NCCOc2ccccc21 |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-5-9-14-13-8-6-7-10-15(13)17-12-11-16-14/h6-8,10,14,16H,2-5,9,11-12H2,1H3 |
| InChIKey | MWUSTQXINIFZKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|