C19H30O — CID 69084900
(3S,4S)-3,4-dipentyl-3,4-dihydro-2H-chromene (PubChem CID 69084900) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (3S,4S)-3,4-dipentyl-3,4-dihydro-2H-chromene.
| Compound Name | (3S,4S)-3,4-dipentyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 69084900 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (3S,4S)-3,4-dipentyl-3,4-dihydro-2H-chromene |
| SMILES | CCCCC[C@@H]1COc2ccccc2[C@H]1CCCCC |
| InChI | InChI=1S/C19H30O/c1-3-5-7-11-16-15-20-19-14-10-9-13-18(19)17(16)12-8-6-4-2/h9-10,13-14,16-17H,3-8,11-12,15H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | WHQIQLIBNNRBEJ-SJORKVTESA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|