About 9-nonyl-9H-fluorene
9-nonyl-9H-fluorene (PubChem CID 22568532) has the molecular formula C22H28
and a molecular weight of 292.47 g/mol. Its IUPAC name is 9-nonyl-9H-fluorene.
Molecular Properties
| Compound Name | 9-nonyl-9H-fluorene |
| PubChem CID | 22568532 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 9-nonyl-9H-fluorene |
| SMILES | CCCCCCCCCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H28/c1-2-3-4-5-6-7-8-13-18-19-14-9-11-16-21(19)22-17-12-10-15-20(18)22/h9-12,14-18H,2-8,13H2,1H3 |
| InChIKey | PXNAGCPTYYVRKU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-nonyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nonyl-9H-fluorene?
The IUPAC name of 9-nonyl-9H-fluorene (CID 22568532) is 9-nonyl-9H-fluorene.
What is the SMILES notation for 9-nonyl-9H-fluorene?
The canonical SMILES for 9-nonyl-9H-fluorene is CCCCCCCCCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9-nonyl-9H-fluorene?
The InChIKey is PXNAGCPTYYVRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28/c1-2-3-4-5-6-7-8-13-18-19-14-9-11-16-21(19)22-17-12-10-15-20(18)22/h9-12,14-18H,2-8,13H2,1H3.
What are the key properties of 9-nonyl-9H-fluorene?
9-nonyl-9H-fluorene has a molecular weight of 292.47 g/mol, XLogP of 6.94, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nonyl-9H-fluorene is sourced from PubChem (CID 22568532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).