C16H22Se — CID 141438474
4-hexyl-3,4-dihydro-2H-naphthalene-1-selone (PubChem CID 141438474) has the molecular formula C16H22Se and a molecular weight of 293.31 g/mol. Its IUPAC name is 4-hexyl-3,4-dihydro-2H-naphthalene-1-selone.
| Compound Name | 4-hexyl-3,4-dihydro-2H-naphthalene-1-selone |
|---|---|
| PubChem CID | 141438474 |
| Molecular Formula | C16H22Se |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-hexyl-3,4-dihydro-2H-naphthalene-1-selone |
| SMILES | CCCCCCC1CCC(=[Se])c2ccccc21 |
| InChI | InChI=1S/C16H22Se/c1-2-3-4-5-8-13-11-12-16(17)15-10-7-6-9-14(13)15/h6-7,9-10,13H,2-5,8,11-12H2,1H3 |
| InChIKey | BAXKWGYYKAMLKX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|