About 4-butyl-3,4-dihydro-2H-isoquinolin-1-one
4-butyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 54043553) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-butyl-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-butyl-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 54043553 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-butyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CCCCC1CNC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H17NO/c1-2-3-6-10-9-14-13(15)12-8-5-4-7-11(10)12/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,14,15) |
| InChIKey | FFZBFOLNMPQOCG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 4-butyl-3,4-dihydro-2H-isoquinolin-1-one (CID 54043553) is 4-butyl-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 4-butyl-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 4-butyl-3,4-dihydro-2H-isoquinolin-1-one is CCCCC1CNC(=O)c2ccccc21.
What is the InChIKey of 4-butyl-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is FFZBFOLNMPQOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-3-6-10-9-14-13(15)12-8-5-4-7-11(10)12/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,14,15).
What are the key properties of 4-butyl-3,4-dihydro-2H-isoquinolin-1-one?
4-butyl-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 203.29 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 54043553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).