C24H45ClN2 — CID 70573589
N-butylbutan-1-amine;3-butyl-2,3-dihydro-1H-indole;2-chlorobutane (PubChem CID 70573589) has the molecular formula C24H45ClN2 and a molecular weight of 397.09 g/mol. Its IUPAC name is N-butylbutan-1-amine;3-butyl-2,3-dihydro-1H-indole;2-chlorobutane.
| Compound Name | N-butylbutan-1-amine;3-butyl-2,3-dihydro-1H-indole;2-chlorobutane |
|---|---|
| PubChem CID | 70573589 |
| Molecular Formula | C24H45ClN2 |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 396.33 |
| IUPAC Name | N-butylbutan-1-amine;3-butyl-2,3-dihydro-1H-indole;2-chlorobutane |
| SMILES | CCC(C)Cl.CCCCC1CNc2ccccc21.CCCCNCCCC |
| InChI | InChI=1S/C12H17N.C8H19N.C4H9Cl/c1-2-3-6-10-9-13-12-8-5-4-7-11(10)12;1-3-5-7-9-8-6-4-2;1-3-4(2)5/h4-5,7-8,10,13H,2-3,6,9H2,1H3;9H,3-8H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | RMJWGSMMCDATCF-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|