C11H14N2O — CID 89199878
N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]formamide (PubChem CID 89199878) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]formamide.
| Compound Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]formamide |
|---|---|
| PubChem CID | 89199878 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]formamide |
| SMILES | O=CNCCC1CNc2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c14-8-12-6-5-9-7-13-11-4-2-1-3-10(9)11/h1-4,8-9,13H,5-7H2,(H,12,14) |
| InChIKey | KQMYBCBYCGKYIU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|