C14H17N3S — CID 80577045
2-(2,3-dihydro-1H-indol-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 80577045) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,3-dihydro-1H-indol-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80577045 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | c1ccc2c(c1)NCC2CCNCc1nccs1 |
| InChI | InChI=1S/C14H17N3S/c1-2-4-13-12(3-1)11(9-17-13)5-6-15-10-14-16-7-8-18-14/h1-4,7-8,11,15,17H,5-6,9-10H2 |
| InChIKey | YFCWWJZYYGCODK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|