C15H22N2 — CID 115105527
N-[3-(2,3-dihydro-1H-indol-3-yl)propyl]cyclobutanamine (PubChem CID 115105527) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1H-indol-3-yl)propyl]cyclobutanamine.
| Compound Name | N-[3-(2,3-dihydro-1H-indol-3-yl)propyl]cyclobutanamine |
|---|---|
| PubChem CID | 115105527 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[3-(2,3-dihydro-1H-indol-3-yl)propyl]cyclobutanamine |
| SMILES | c1ccc2c(c1)NCC2CCCNC1CCC1 |
| InChI | InChI=1S/C15H22N2/c1-2-9-15-14(8-1)12(11-17-15)5-4-10-16-13-6-3-7-13/h1-2,8-9,12-13,16-17H,3-7,10-11H2 |
| InChIKey | JQPGLIUWRDOLBT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|