C10H13N — CID 92797412
(3R)-3-ethyl-2,3-dihydro-1H-indole (PubChem CID 92797412) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (3R)-3-ethyl-2,3-dihydro-1H-indole.
| Compound Name | (3R)-3-ethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 92797412 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (3R)-3-ethyl-2,3-dihydro-1H-indole |
| SMILES | CC[C@H]1CNc2ccccc21 |
| InChI | InChI=1S/C10H13N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h3-6,8,11H,2,7H2,1H3/t8-/m0/s1 |
| InChIKey | AYIYBBZENMJOER-QMMMGPOBSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |