C12H15NO — CID 145312543
3-(2-methoxyprop-2-enyl)-2,3-dihydro-1H-indole (PubChem CID 145312543) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(2-methoxyprop-2-enyl)-2,3-dihydro-1H-indole.
| Compound Name | 3-(2-methoxyprop-2-enyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 145312543 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(2-methoxyprop-2-enyl)-2,3-dihydro-1H-indole |
| SMILES | C=C(CC1CNc2ccccc21)OC |
| InChI | InChI=1S/C12H15NO/c1-9(14-2)7-10-8-13-12-6-4-3-5-11(10)12/h3-6,10,13H,1,7-8H2,2H3 |
| InChIKey | DMBVOLSTNGLQFO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|