About 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene
3-ethyl-2,3-dihydro-1H-indole;fluorobenzene (PubChem CID 174405299) has the molecular formula C16H18FN
and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene.
Molecular Properties
| Compound Name | 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene |
| PubChem CID | 174405299 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene |
| SMILES | CCC1CNc2ccccc21.Fc1ccccc1 |
| InChI | InChI=1S/C10H13N.C6H5F/c1-2-8-7-11-10-6-4-3-5-9(8)10;7-6-4-2-1-3-5-6/h3-6,8,11H,2,7H2,1H3;1-5H |
| InChIKey | YHBHHTGZSDRXMW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene?
The IUPAC name of 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene (CID 174405299) is 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene.
What is the SMILES notation for 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene?
The canonical SMILES for 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene is CCC1CNc2ccccc21.Fc1ccccc1.
What is the InChIKey of 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene?
The InChIKey is YHBHHTGZSDRXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C6H5F/c1-2-8-7-11-10-6-4-3-5-9(8)10;7-6-4-2-1-3-5-6/h3-6,8,11H,2,7H2,1H3;1-5H.
What are the key properties of 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene?
3-ethyl-2,3-dihydro-1H-indole;fluorobenzene has a molecular weight of 243.33 g/mol, XLogP of 4.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,3-dihydro-1H-indole;fluorobenzene is sourced from PubChem (CID 174405299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).