C11H15NS — CID 83915674
3-ethyl-4-methylsulfanyl-2,3-dihydro-1H-indole (PubChem CID 83915674) has the molecular formula C11H15NS and a molecular weight of 193.32 g/mol. Its IUPAC name is 3-ethyl-4-methylsulfanyl-2,3-dihydro-1H-indole.
| Compound Name | 3-ethyl-4-methylsulfanyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 83915674 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-ethyl-4-methylsulfanyl-2,3-dihydro-1H-indole |
| SMILES | CCC1CNc2cccc(SC)c21 |
| InChI | InChI=1S/C11H15NS/c1-3-8-7-12-9-5-4-6-10(13-2)11(8)9/h4-6,8,12H,3,7H2,1-2H3 |
| InChIKey | FRGSGKXWAJBGDM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |