C9H11FN2O — CID 117199931
O-[(4-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine (PubChem CID 117199931) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is O-[(4-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117199931 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | O-[(4-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine |
| SMILES | NOCC1CNc2cccc(F)c21 |
| InChI | InChI=1S/C9H11FN2O/c10-7-2-1-3-8-9(7)6(4-12-8)5-13-11/h1-3,6,12H,4-5,11H2 |
| InChIKey | HYWZMRJFZGSBMF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|