About propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate
propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate (PubChem CID 79600080) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate |
| PubChem CID | 79600080 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate |
| SMILES | CCCOC(=O)CC1CNc2ccccc21 |
| InChI | InChI=1S/C13H17NO2/c1-2-7-16-13(15)8-10-9-14-12-6-4-3-5-11(10)12/h3-6,10,14H,2,7-9H2,1H3 |
| InChIKey | TXCBYRFEABFBMA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The IUPAC name of propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate (CID 79600080) is propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate.
What is the SMILES notation for propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The canonical SMILES for propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate is CCCOC(=O)CC1CNc2ccccc21.
What is the InChIKey of propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The InChIKey is TXCBYRFEABFBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-7-16-13(15)8-10-9-14-12-6-4-3-5-11(10)12/h3-6,10,14H,2,7-9H2,1H3.
What are the key properties of propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate has a molecular weight of 219.28 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(2,3-dihydro-1H-indol-3-yl)acetate is sourced from PubChem (CID 79600080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).