C18H28N2O — CID 115567924
2-(2,3-dihydro-1H-indol-3-yl)-N-octylacetamide (PubChem CID 115567924) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-3-yl)-N-octylacetamide.
| Compound Name | 2-(2,3-dihydro-1H-indol-3-yl)-N-octylacetamide |
|---|---|
| PubChem CID | 115567924 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-3-yl)-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CC1CNc2ccccc21 |
| InChI | InChI=1S/C18H28N2O/c1-2-3-4-5-6-9-12-19-18(21)13-15-14-20-17-11-8-7-10-16(15)17/h7-8,10-11,15,20H,2-6,9,12-14H2,1H3,(H,19,21) |
| InChIKey | BQSMPCRYPGWBQJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|