C15H22N2O — CID 80565289
N-hexyl-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 80565289) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-hexyl-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-hexyl-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 80565289 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-hexyl-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | CCCCCCNC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C15H22N2O/c1-2-3-4-7-10-16-15(18)13-11-17-14-9-6-5-8-12(13)14/h5-6,8-9,13,17H,2-4,7,10-11H2,1H3,(H,16,18) |
| InChIKey | IKZDGFLEGCZJBS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|