About N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide
N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 103307344) has the molecular formula C12H16N2O3S
and a molecular weight of 268.34 g/mol. Its IUPAC name is N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide |
| PubChem CID | 103307344 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | CCCS(=O)(=O)NC(=O)C1CNc2ccccc21 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-7-18(16,17)14-12(15)10-8-13-11-6-4-3-5-9(10)11/h3-6,10,13H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | JGHNGBIYHATCCP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide?
The IUPAC name of N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide (CID 103307344) is N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide.
What is the SMILES notation for N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide?
The canonical SMILES for N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide is CCCS(=O)(=O)NC(=O)C1CNc2ccccc21.
What is the InChIKey of N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide?
The InChIKey is JGHNGBIYHATCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c1-2-7-18(16,17)14-12(15)10-8-13-11-6-4-3-5-9(10)11/h3-6,10,13H,2,7-8H2,1H3,(H,14,15).
What are the key properties of N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide?
N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide has a molecular weight of 268.34 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylsulfonyl-2,3-dihydro-1H-indole-3-carboxamide is sourced from PubChem (CID 103307344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).