C11H12N2S — CID 4777619
1-phenyl-N-(1,3-thiazol-2-ylmethyl)methanamine (PubChem CID 4777619) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 1-phenyl-N-(1,3-thiazol-2-ylmethyl)methanamine.
| Compound Name | 1-phenyl-N-(1,3-thiazol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 4777619 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-phenyl-N-(1,3-thiazol-2-ylmethyl)methanamine |
| SMILES | c1ccc(CNCc2nccs2)cc1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-10(5-3-1)8-12-9-11-13-6-7-14-11/h1-7,12H,8-9H2 |
| InChIKey | UFWSEPMUQJPVBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |