C12H11N3S — CID 60960478
3-[(1,3-thiazol-2-ylmethylamino)methyl]benzonitrile (PubChem CID 60960478) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 3-[(1,3-thiazol-2-ylmethylamino)methyl]benzonitrile.
| Compound Name | 3-[(1,3-thiazol-2-ylmethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 60960478 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-[(1,3-thiazol-2-ylmethylamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCc2nccs2)c1 |
| InChI | InChI=1S/C12H11N3S/c13-7-10-2-1-3-11(6-10)8-14-9-12-15-4-5-16-12/h1-6,14H,8-9H2 |
| InChIKey | SUSHATMHCKZJIB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |