C11H8N2S2 — CID 60552938
3-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile (PubChem CID 60552938) has the molecular formula C11H8N2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile.
| Compound Name | 3-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
|---|---|
| PubChem CID | 60552938 |
| Molecular Formula | C11H8N2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 3-(1,3-thiazol-2-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1cccc(CSc2nccs2)c1 |
| InChI | InChI=1S/C11H8N2S2/c12-7-9-2-1-3-10(6-9)8-15-11-13-4-5-14-11/h1-6H,8H2 |
| InChIKey | SNSKULHIEOTHKL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|