C12H10N2O2S3 — CID 115563482
3-[2-(1,3-thiazol-2-ylsulfanyl)ethylsulfonyl]benzonitrile (PubChem CID 115563482) has the molecular formula C12H10N2O2S3 and a molecular weight of 310.43 g/mol. Its IUPAC name is 3-[2-(1,3-thiazol-2-ylsulfanyl)ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-(1,3-thiazol-2-ylsulfanyl)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 115563482 |
| Molecular Formula | C12H10N2O2S3 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 3-[2-(1,3-thiazol-2-ylsulfanyl)ethylsulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)CCSc2nccs2)c1 |
| InChI | InChI=1S/C12H10N2O2S3/c13-9-10-2-1-3-11(8-10)19(15,16)7-6-18-12-14-4-5-17-12/h1-5,8H,6-7H2 |
| InChIKey | UPCFWTFYMORUHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|