C16H18N2O2S2 — CID 84590117
3-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]ethylsulfonyl]benzonitrile (PubChem CID 84590117) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 3-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]ethylsulfonyl]benzonitrile.
| Compound Name | 3-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 84590117 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[2-[methyl-[(3-methylthiophen-2-yl)methyl]amino]ethylsulfonyl]benzonitrile |
| SMILES | Cc1ccsc1CN(C)CCS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H18N2O2S2/c1-13-6-8-21-16(13)12-18(2)7-9-22(19,20)15-5-3-4-14(10-15)11-17/h3-6,8,10H,7,9,12H2,1-2H3 |
| InChIKey | MXQHTRXSXVQQGT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |